CAS 6726-54-1 is the registry number for Ethyl 4-methylpyrazolo[5,1-c][1,2,4]triazine-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Ethyl 4-methylpyrazolo[5,1-c][1,2,4]triazine-3-carboxylate (CAS 6726-54-1) is a chemical compound with the molecular formula C9H10N4O2 and a molecular weight of 206.20 g/mol. IUPAC name: ethyl 4-methylpyrazolo[5,1-c][1,2,4]triazine-3-carboxylate. InChIKey: KUPXRESOEITXQM-UHFFFAOYSA-N.
| Molecular formula | C9H10N4O2 |
|---|---|
| Molecular weight | 206.20 g/mol |
| IUPAC name | ethyl 4-methylpyrazolo[5,1-c][1,2,4]triazine-3-carboxylate |
| InChIKey | KUPXRESOEITXQM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N2C(=CC=N2)N=N1)C |
Computed by PubChem (NCBI)