CAS 256348-41-1 appears in our catalog under these names: (5,7-Dimethyl[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)acetic acid, 95%, (5,7-Dimethyl-(1,2,4)triazolo(1,5-a)pyrimidin-2-yl)-acetic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 100mg.
2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)acetic acid (CAS 256348-41-1) is a chemical compound with the molecular formula C9H10N4O2 and a molecular weight of 206.20 g/mol. IUPAC name: 2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)acetic acid. InChIKey: PFEYZNRDVANGLJ-UHFFFAOYSA-N.
| Molecular formula | C9H10N4O2 |
|---|---|
| Molecular weight | 206.20 g/mol |
| IUPAC name | 2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)acetic acid |
| InChIKey | PFEYZNRDVANGLJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=NC(=NN12)CC(=O)O)C |
Computed by PubChem (NCBI)