CAS 1852-86-4 appears in our catalog under these names: 3-O-Propyl Estrone, Estrone Impurity 20. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(8R,9S,13S,14S)-13-methyl-3-propoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (CAS 1852-86-4) is a chemical compound with the molecular formula C21H28O2 and a molecular weight of 312.4 g/mol. IUPAC name: (8R,9S,13S,14S)-13-methyl-3-propoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one. InChIKey: JEQDUPLREMIUDB-BNDYYXHWSA-N.
| Molecular formula | C21H28O2 |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | (8R,9S,13S,14S)-13-methyl-3-propoxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| InChIKey | JEQDUPLREMIUDB-BNDYYXHWSA-N |
| SMILES | CCCOC1=CC2=C(C=C1)[C@H]3CC[C@]4([C@H]([C@@H]3CC2)CCC4=O)C |
Computed by PubChem (NCBI)