CAS 24377-08-0 appears in our catalog under these names: Progesterone EP Impurity A (Pregna-4,14-diene-3,20-dione), Progesterone EP Impurity A, Progesterone Impurity 1(Progesterone EP Impurity A), Pregna-4,14-diene-3,20-dione, >95% (HPLC), Pregna-4,14-diene-3,20-dione. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 2mg, 1mg.
(8R,9S,10R,13R,17S)-17-acetyl-10,13-dimethyl-1,2,6,7,8,9,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-one (CAS 24377-08-0) is a chemical compound with the molecular formula C21H28O2 and a molecular weight of 312.4 g/mol. IUPAC name: (8R,9S,10R,13R,17S)-17-acetyl-10,13-dimethyl-1,2,6,7,8,9,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-one. InChIKey: IXCUVBOSDZZTGA-YZUZWNONSA-N.
| Molecular formula | C21H28O2 |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | (8R,9S,10R,13R,17S)-17-acetyl-10,13-dimethyl-1,2,6,7,8,9,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| InChIKey | IXCUVBOSDZZTGA-YZUZWNONSA-N |
| SMILES | CC(=O)[C@H]1CC=C2[C@@]1(CC[C@H]3[C@H]2CCC4=CC(=O)CC[C@]34C)C |
Computed by PubChem (NCBI)