Products 1852354-01-8
CAS 1852354-01-8 is the registry number for 2-[2-(Trifluoromethyl)pyridin-4-yl]propanoic Acid, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-[2-(trifluoromethyl)-4-pyridinyl]propanoic acid (CAS 1852354-01-8) is a chemical compound with the molecular formula C9H8F3NO2 and a molecular weight of 219.16 g/mol. IUPAC name: 2-[2-(trifluoromethyl)-4-pyridinyl]propanoic acid. InChIKey: AGJCYZGJEXZNOB-UHFFFAOYSA-N.
| Molecular formula | C9H8F3NO2 |
|---|---|
| Molecular weight | 219.16 g/mol |
| IUPAC name | 2-[2-(trifluoromethyl)-4-pyridinyl]propanoic acid |
| InChIKey | AGJCYZGJEXZNOB-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=NC=C1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)