Products 1853217-61-4
CAS 1853217-61-4 is the registry number for 4-(3,4,5-Trichlorophenyl)piperidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(3,4,5-trichlorophenyl)piperidine (CAS 1853217-61-4) is a chemical compound with the molecular formula C11H12Cl3N and a molecular weight of 264.6 g/mol. IUPAC name: 4-(3,4,5-trichlorophenyl)piperidine. InChIKey: VSEWXYZCISEIEV-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl3N |
|---|---|
| Molecular weight | 264.6 g/mol |
| IUPAC name | 4-(3,4,5-trichlorophenyl)piperidine |
| InChIKey | VSEWXYZCISEIEV-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C2=CC(=C(C(=C2)Cl)Cl)Cl |
Computed by PubChem (NCBI)