CAS 86215-36-3 appears in our catalog under these names: 1-(3,4-Dichloro-phenyl)-3-aza-bicyclo[3.1.0]hexane hydrochloride, 95%, DOV 216,303, DOV-216,303. Offered by: Combi-blocks, Sigma-Aldrich, MedChemExpress. Available pack sizes: 5g, 1g, 10g, 250mg, 25MG, Get quote.
(1R,5S)-1-(3,4-dichlorophenyl)-3-azabicyclo[3.1.0]hexane;hydrochloride (CAS 86215-36-3) is a chemical compound with the molecular formula C11H12Cl3N and a molecular weight of 264.6 g/mol. IUPAC name: (1R,5S)-1-(3,4-dichlorophenyl)-3-azabicyclo[3.1.0]hexane;hydrochloride. InChIKey: KAGBHVBIOJBGBD-NINOIYOQSA-N.
| Molecular formula | C11H12Cl3N |
|---|---|
| Molecular weight | 264.6 g/mol |
| IUPAC name | (1R,5S)-1-(3,4-dichlorophenyl)-3-azabicyclo[3.1.0]hexane;hydrochloride |
| InChIKey | KAGBHVBIOJBGBD-NINOIYOQSA-N |
| SMILES | C1[C@H]2[C@@]1(CNC2)C3=CC(=C(C=C3)Cl)Cl.Cl |
Computed by PubChem (NCBI)