CAS 946593-09-5 appears in our catalog under these names: 4-(3,4-Dichlorophenyl)-1,2,3,6-tetrahydropyridine hydrochloride, 95%, 4-(3,4-Dichlorophenyl)-1,2,3,6-tetrahydropyridine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4-(3,4-dichlorophenyl)-1,2,3,6-tetrahydropyridine;hydrochloride (CAS 946593-09-5) is a chemical compound with the molecular formula C11H12Cl3N and a molecular weight of 264.6 g/mol. IUPAC name: 4-(3,4-dichlorophenyl)-1,2,3,6-tetrahydropyridine;hydrochloride. InChIKey: KUXJCRHVVUAUGO-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl3N |
|---|---|
| Molecular weight | 264.6 g/mol |
| IUPAC name | 4-(3,4-dichlorophenyl)-1,2,3,6-tetrahydropyridine;hydrochloride |
| InChIKey | KUXJCRHVVUAUGO-UHFFFAOYSA-N |
| SMILES | C1CNCC=C1C2=CC(=C(C=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)