CAS 185342-88-5 appears in our catalog under these names: 1,3–Dibromo–2,4–dimethoxybenzene, 1,3-Dibromo-2,4-dimethoxybenzene, 1,3-Dibromo-2,4-dimethoxybenzene, 95%, 95%, 1,3-Dibromo-2,4-dimethoxybenzene, 95+%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 200mg, 5g, 2,5g, 250mg, 100mg.
1,3-dibromo-2,4-dimethoxybenzene (CAS 185342-88-5) is a chemical compound with the molecular formula C8H8Br2O2 and a molecular weight of 295.96 g/mol. IUPAC name: 1,3-dibromo-2,4-dimethoxybenzene. InChIKey: UZFUWYMMUGVSCE-UHFFFAOYSA-N.
| Molecular formula | C8H8Br2O2 |
|---|---|
| Molecular weight | 295.96 g/mol |
| IUPAC name | 1,3-dibromo-2,4-dimethoxybenzene |
| InChIKey | UZFUWYMMUGVSCE-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)Br)OC)Br |
Computed by PubChem (NCBI)