Products 770718-88-2

CAS 770718-88-2 is the registry number for 1,3-Dibromo-5-(methoxymethoxy)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 100g, 5g, 1g.

Structural formula: {0} (CAS {1})

1,3-dibromo-5-(methoxymethoxy)benzene (CAS 770718-88-2) is a chemical compound with the molecular formula C8H8Br2O2 and a molecular weight of 295.96 g/mol. IUPAC name: 1,3-dibromo-5-(methoxymethoxy)benzene. InChIKey: PXQPTTGFBUMOLE-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8Br2O2
Molecular weight295.96 g/mol
IUPAC name1,3-dibromo-5-(methoxymethoxy)benzene
InChIKeyPXQPTTGFBUMOLE-UHFFFAOYSA-N
SMILESCOCOC1=CC(=CC(=C1)Br)Br

Computed by PubChem (NCBI)