CAS 303009-05-4 appears in our catalog under these names: 2,6-Dibromo-4-(2-hydroxyethyl)phenol, 2,6-Dibromo-4-(2-hydroxyethyl)phenol, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 2,5g, 250mg, 5g.
2,6-dibromo-4-(2-hydroxyethyl)phenol (CAS 303009-05-4) is a chemical compound with the molecular formula C8H8Br2O2 and a molecular weight of 295.96 g/mol. IUPAC name: 2,6-dibromo-4-(2-hydroxyethyl)phenol. InChIKey: WHTOEXMWXOHKGG-UHFFFAOYSA-N.
| Molecular formula | C8H8Br2O2 |
|---|---|
| Molecular weight | 295.96 g/mol |
| IUPAC name | 2,6-dibromo-4-(2-hydroxyethyl)phenol |
| InChIKey | WHTOEXMWXOHKGG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)O)Br)CCO |
Computed by PubChem (NCBI)