Products 185407-26-5
CAS 185407-26-5 is the registry number for 7-Methoxy-2,3-dihydrobenzofuran-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-methoxy-2,3-dihydro-1-benzofuran-4-carboxylic acid (CAS 185407-26-5) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: 7-methoxy-2,3-dihydro-1-benzofuran-4-carboxylic acid. InChIKey: AXMYIRRALJTEGA-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | 7-methoxy-2,3-dihydro-1-benzofuran-4-carboxylic acid |
| InChIKey | AXMYIRRALJTEGA-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=C(C=C1)C(=O)O)CCO2 |
Computed by PubChem (NCBI)