CAS 18545-97-6 is the registry number for (2R,3R,4R,5R)-6,6-Bis(ethylthio)hexane-1,2,3,4,5-pentaol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,3R,4R,5R)-6,6-bis(ethylsulfanyl)hexane-1,2,3,4,5-pentol (CAS 18545-97-6) is a chemical compound with the molecular formula C10H22O5S2 and a molecular weight of 286.4 g/mol. IUPAC name: (2R,3R,4R,5R)-6,6-bis(ethylsulfanyl)hexane-1,2,3,4,5-pentol. InChIKey: BTOYCPDACQXQRS-FNCVBFRFSA-N.
| Molecular formula | C10H22O5S2 |
|---|---|
| Molecular weight | 286.4 g/mol |
| IUPAC name | (2R,3R,4R,5R)-6,6-bis(ethylsulfanyl)hexane-1,2,3,4,5-pentol |
| InChIKey | BTOYCPDACQXQRS-FNCVBFRFSA-N |
| SMILES | CCSC([C@@H]([C@@H]([C@@H]([C@@H](CO)O)O)O)O)SCC |
Computed by PubChem (NCBI)