CAS 1941-52-2 appears in our catalog under these names: D-Glucose diethyl mercaptal, 98%, D–Glucose Diethyl Mercaptal, D-Glucose diethyl mercaptal, (2R,3R,4S,5R)-6,6-Bis(ethylthio)hexane-1,2,3,4,5-pentaol, 98.0%, 98.0%, (2R,3R,4S,5R)-6,6-bis(ethylthio)hexane-1,2,3,4,5-pentaol, ≥98%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 2000mg, 1000mg.
(2R,3R,4S,5R)-6,6-bis(ethylsulfanyl)hexane-1,2,3,4,5-pentol (CAS 1941-52-2) is a chemical compound with the molecular formula C10H22O5S2 and a molecular weight of 286.4 g/mol. IUPAC name: (2R,3R,4S,5R)-6,6-bis(ethylsulfanyl)hexane-1,2,3,4,5-pentol. InChIKey: BTOYCPDACQXQRS-LURQLKTLSA-N.
| Molecular formula | C10H22O5S2 |
|---|---|
| Molecular weight | 286.4 g/mol |
| IUPAC name | (2R,3R,4S,5R)-6,6-bis(ethylsulfanyl)hexane-1,2,3,4,5-pentol |
| InChIKey | BTOYCPDACQXQRS-LURQLKTLSA-N |
| SMILES | CCSC([C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O)SCC |
Computed by PubChem (NCBI)