CAS 5463-33-2 appears in our catalog under these names: D-Galactose diethyldithioacetal, (2R,3S,4S,5R)–6,6–bis(ethylthio)hexane–1,2,3,4,5–pentaol. Offered by: TRC, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 0,5g, 10g, 2g, 5g.
(2R,3S,4S,5R)-6,6-bis(ethylsulfanyl)hexane-1,2,3,4,5-pentol (CAS 5463-33-2) is a chemical compound with the molecular formula C10H22O5S2 and a molecular weight of 286.4 g/mol. IUPAC name: (2R,3S,4S,5R)-6,6-bis(ethylsulfanyl)hexane-1,2,3,4,5-pentol. InChIKey: BTOYCPDACQXQRS-RYPBNFRJSA-N.
| Molecular formula | C10H22O5S2 |
|---|---|
| Molecular weight | 286.4 g/mol |
| IUPAC name | (2R,3S,4S,5R)-6,6-bis(ethylsulfanyl)hexane-1,2,3,4,5-pentol |
| InChIKey | BTOYCPDACQXQRS-RYPBNFRJSA-N |
| SMILES | CCSC([C@@H]([C@H]([C@H]([C@@H](CO)O)O)O)O)SCC |
Computed by PubChem (NCBI)