CAS 1854905-53-5 is the registry number for 3-((4-Methylpyridin-3-yl)amino)thietane 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(1,1-dioxothietan-3-yl)-4-methylpyridin-3-amine (CAS 1854905-53-5) is a chemical compound with the molecular formula C9H12N2O2S and a molecular weight of 212.27 g/mol. IUPAC name: N-(1,1-dioxothietan-3-yl)-4-methylpyridin-3-amine. InChIKey: HQIPCERJZORFEB-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O2S |
|---|---|
| Molecular weight | 212.27 g/mol |
| IUPAC name | N-(1,1-dioxothietan-3-yl)-4-methylpyridin-3-amine |
| InChIKey | HQIPCERJZORFEB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NC=C1)NC2CS(=O)(=O)C2 |
Computed by PubChem (NCBI)