Products 185508-03-6
CAS 185508-03-6 is the registry number for Clauszoline B. Offered by: MedChemExpress. Available pack sizes: Get quote.
9-hydroxy-2,2-dimethyl-11H-pyrano[2,3-a]carbazole-8-carbaldehyde (CAS 185508-03-6) is a chemical compound with the molecular formula C18H15NO3 and a molecular weight of 293.3 g/mol. IUPAC name: 9-hydroxy-2,2-dimethyl-11H-pyrano[2,3-a]carbazole-8-carbaldehyde. InChIKey: GARDKJDDEDZERK-UHFFFAOYSA-N.
| Molecular formula | C18H15NO3 |
|---|---|
| Molecular weight | 293.3 g/mol |
| IUPAC name | 9-hydroxy-2,2-dimethyl-11H-pyrano[2,3-a]carbazole-8-carbaldehyde |
| InChIKey | GARDKJDDEDZERK-UHFFFAOYSA-N |
| SMILES | CC1(C=CC2=C(O1)C3=C(C=C2)C4=C(N3)C=C(C(=C4)C=O)O)C |
Computed by PubChem (NCBI)
Synonyms:
Clauszoline B, orb1991299