CAS 185556-32-5 is the registry number for 3-Methyl-2,3,4,9-tetrahydro-1H-carbazole-8-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
6-methyl-6,7,8,9-tetrahydro-5H-carbazole-1-carboxylic acid (CAS 185556-32-5) is a chemical compound with the molecular formula C14H15NO2 and a molecular weight of 229.27 g/mol. IUPAC name: 6-methyl-6,7,8,9-tetrahydro-5H-carbazole-1-carboxylic acid. InChIKey: YDECTAHOPWOBON-UHFFFAOYSA-N.
| Molecular formula | C14H15NO2 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | 6-methyl-6,7,8,9-tetrahydro-5H-carbazole-1-carboxylic acid |
| InChIKey | YDECTAHOPWOBON-UHFFFAOYSA-N |
| SMILES | CC1CCC2=C(C1)C3=C(N2)C(=CC=C3)C(=O)O |
Computed by PubChem (NCBI)