CAS 1857-56-3 appears in our catalog under these names: 3–(3–Chloro–4–methoxyphenyl)propanoic acid, 3-(3-Chloro-4-methoxyphenyl)propionic acid, 3-(3-Chloro-4-methoxyphenyl)propanoic acid, 95%, 3-(3-Chloro-4-methoxyphenyl)propanoic acid 95%, 3-(3-Chloro-4-methoxyphenyl)propanoic acid, 95%, 95%. Offered by: GLPBio, Biosynth, Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 25g, 100mg.
3-(3-chloro-4-methoxyphenyl)propanoic acid (CAS 1857-56-3) is a chemical compound with the molecular formula C10H11ClO3 and a molecular weight of 214.64 g/mol. IUPAC name: 3-(3-chloro-4-methoxyphenyl)propanoic acid. InChIKey: MAYOFTZUJPQKET-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO3 |
|---|---|
| Molecular weight | 214.64 g/mol |
| IUPAC name | 3-(3-chloro-4-methoxyphenyl)propanoic acid |
| InChIKey | MAYOFTZUJPQKET-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)CCC(=O)O)Cl |
Computed by PubChem (NCBI)