Products 1857348-83-4
CAS 1857348-83-4 is the registry number for 5-Bromo-7-fluoro-2,3-dihydro-1H-inden-1-ol, 95%. Offered by: Chemat. Available pack sizes: 1g.
5-bromo-7-fluoro-2,3-dihydro-1H-inden-1-ol (CAS 1857348-83-4) is a chemical compound with the molecular formula C9H8BrFO and a molecular weight of 231.06 g/mol. IUPAC name: 5-bromo-7-fluoro-2,3-dihydro-1H-inden-1-ol. InChIKey: OFMGOPGWVYQNQW-UHFFFAOYSA-N.
| Molecular formula | C9H8BrFO |
|---|---|
| Molecular weight | 231.06 g/mol |
| IUPAC name | 5-bromo-7-fluoro-2,3-dihydro-1H-inden-1-ol |
| InChIKey | OFMGOPGWVYQNQW-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1O)C(=CC(=C2)Br)F |
Computed by PubChem (NCBI)