CAS 185739-16-6 is the registry number for 1-(2,2-Difluoro-ethenyl)naphthalene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
1-(2,2-difluoroethenyl)naphthalene (CAS 185739-16-6) is a chemical compound with the molecular formula C12H8F2 and a molecular weight of 190.19 g/mol. IUPAC name: 1-(2,2-difluoroethenyl)naphthalene. InChIKey: AKLOXTFUKXSWSK-UHFFFAOYSA-N.
| Molecular formula | C12H8F2 |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | 1-(2,2-difluoroethenyl)naphthalene |
| InChIKey | AKLOXTFUKXSWSK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C=C(F)F |
Computed by PubChem (NCBI)