CAS 388-82-9 appears in our catalog under these names: 2,2'-Difluorobiphenyl, 95%, 2,2'-Difluoro-1,1'-biphenyl, 97%, 2,2'-Difluorobiphenyl (PFB 4), 2,2'-Difluorobiphenyl (PFB 4) 2000 µg/mL in Methyl-tert-butyl ether, 2,2'–Difluorobiphenyl. Offered by: Combi-blocks, AmBeed, Dr. Ehrenstorfer, GLPBio, Sigma-Aldrich. Available pack sizes: 5g, 25g, 1g, 100mg, 1ml, 250mg.
1-fluoro-2-(2-fluorophenyl)benzene (CAS 388-82-9) is a chemical compound with the molecular formula C12H8F2 and a molecular weight of 190.19 g/mol. IUPAC name: 1-fluoro-2-(2-fluorophenyl)benzene. InChIKey: PXFIPIAXFGAEMJ-UHFFFAOYSA-N.
| Molecular formula | C12H8F2 |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | 1-fluoro-2-(2-fluorophenyl)benzene |
| InChIKey | PXFIPIAXFGAEMJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=CC=C2F)F |
Computed by PubChem (NCBI)