CAS 67277-32-1 is the registry number for 2,3-Difluorobiphenyl, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
1,2-difluoro-3-phenylbenzene (CAS 67277-32-1) is a chemical compound with the molecular formula C12H8F2 and a molecular weight of 190.19 g/mol. IUPAC name: 1,2-difluoro-3-phenylbenzene. InChIKey: YHAYNOYJLJHNSE-UHFFFAOYSA-N.
| Molecular formula | C12H8F2 |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | 1,2-difluoro-3-phenylbenzene |
| InChIKey | YHAYNOYJLJHNSE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C(=CC=C2)F)F |
Computed by PubChem (NCBI)