CAS 1858255-03-4 is the registry number for 6-Methyl-4-(methylsulfonyl)-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
6-methyl-4-methylsulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid (CAS 1858255-03-4) is a chemical compound with the molecular formula C11H13NO5S and a molecular weight of 271.29 g/mol. IUPAC name: 6-methyl-4-methylsulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid. InChIKey: QANSTVADCKQCPM-UHFFFAOYSA-N.
| Molecular formula | C11H13NO5S |
|---|---|
| Molecular weight | 271.29 g/mol |
| IUPAC name | 6-methyl-4-methylsulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid |
| InChIKey | QANSTVADCKQCPM-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)OC(CN2S(=O)(=O)C)C(=O)O |
Computed by PubChem (NCBI)