CAS 300670-60-4 appears in our catalog under these names: 3-((4-Acetamidophenyl)sulfonyl)propanoic acid, 95+%, 3-([4-(Acetylamino)phenyl]sulfonyl)propanoic acid, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
3-(4-acetamidophenyl)sulfonylpropanoic acid (CAS 300670-60-4) is a chemical compound with the molecular formula C11H13NO5S and a molecular weight of 271.29 g/mol. IUPAC name: 3-(4-acetamidophenyl)sulfonylpropanoic acid. InChIKey: OHZRFPJQOHWDNK-UHFFFAOYSA-N.
| Molecular formula | C11H13NO5S |
|---|---|
| Molecular weight | 271.29 g/mol |
| IUPAC name | 3-(4-acetamidophenyl)sulfonylpropanoic acid |
| InChIKey | OHZRFPJQOHWDNK-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)S(=O)(=O)CCC(=O)O |
Computed by PubChem (NCBI)