Products 953734-90-2
CAS 953734-90-2 is the registry number for 4-(Ethylsulfonyl)-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
4-ethylsulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid (CAS 953734-90-2) is a chemical compound with the molecular formula C11H13NO5S and a molecular weight of 271.29 g/mol. IUPAC name: 4-ethylsulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid. InChIKey: OTUARFQEKVJAJN-UHFFFAOYSA-N.
| Molecular formula | C11H13NO5S |
|---|---|
| Molecular weight | 271.29 g/mol |
| IUPAC name | 4-ethylsulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid |
| InChIKey | OTUARFQEKVJAJN-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)N1CC(OC2=CC=CC=C21)C(=O)O |
Computed by PubChem (NCBI)