Products 1858257-23-4

CAS 1858257-23-4 is the registry number for N-(Methylsulfonyl)-n-[4-(trifluoromethyl)phenyl]glycine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-[N-methylsulfonyl-4-(trifluoromethyl)anilino]acetic acid (CAS 1858257-23-4) is a chemical compound with the molecular formula C10H10F3NO4S and a molecular weight of 297.25 g/mol. IUPAC name: 2-[N-methylsulfonyl-4-(trifluoromethyl)anilino]acetic acid. InChIKey: INZLLMGSIMBLQJ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10F3NO4S
Molecular weight297.25 g/mol
IUPAC name2-[N-methylsulfonyl-4-(trifluoromethyl)anilino]acetic acid
InChIKeyINZLLMGSIMBLQJ-UHFFFAOYSA-N
SMILESCS(=O)(=O)N(CC(=O)O)C1=CC=C(C=C1)C(F)(F)F

Computed by PubChem (NCBI)