CAS 250714-51-3 appears in our catalog under these names: 2–(3–(Trifluoromethyl)benzenesulfonamido)propanoic acid, 2-(3-(Trifluoromethyl)benzenesulfonamido)propanoic acid. Offered by: GLPBio, Biosynth. Available pack sizes: 1g, 5g.
2-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanoic acid (CAS 250714-51-3) is a chemical compound with the molecular formula C10H10F3NO4S and a molecular weight of 297.25 g/mol. IUPAC name: 2-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanoic acid. InChIKey: OZVPEEXYQQFKJL-UHFFFAOYSA-N.
| Molecular formula | C10H10F3NO4S |
|---|---|
| Molecular weight | 297.25 g/mol |
| IUPAC name | 2-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanoic acid |
| InChIKey | OZVPEEXYQQFKJL-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)NS(=O)(=O)C1=CC=CC(=C1)C(F)(F)F |
Computed by PubChem (NCBI)