Products 288266-54-6

CAS 288266-54-6 is the registry number for 2-([[3-(Trifluoromethyl)phenyl]sulfonyl]amino)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanoic acid (CAS 288266-54-6) is a chemical compound with the molecular formula C10H10F3NO4S and a molecular weight of 297.25 g/mol. IUPAC name: 2-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanoic acid. InChIKey: OZVPEEXYQQFKJL-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10F3NO4S
Molecular weight297.25 g/mol
IUPAC name2-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanoic acid
InChIKeyOZVPEEXYQQFKJL-UHFFFAOYSA-N
SMILESCC(C(=O)O)NS(=O)(=O)C1=CC=CC(=C1)C(F)(F)F

Computed by PubChem (NCBI)