CAS 18588-49-3 appears in our catalog under these names: 5-Phenylpyrimidine-2,4-diamine, 98%, 5-Phenylpyrimidine-2,4-diamine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
5-phenylpyrimidine-2,4-diamine (CAS 18588-49-3) is a chemical compound with the molecular formula C10H10N4 and a molecular weight of 186.21 g/mol. IUPAC name: 5-phenylpyrimidine-2,4-diamine. InChIKey: FUVWRUJASRBHEK-UHFFFAOYSA-N.
| Molecular formula | C10H10N4 |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | 5-phenylpyrimidine-2,4-diamine |
| InChIKey | FUVWRUJASRBHEK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN=C(N=C2N)N |
Computed by PubChem (NCBI)