Products 1859126-50-3
CAS 1859126-50-3 is the registry number for Methyl 4-amino-3-ethynyl-5-methylbenzoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 4-amino-3-ethynyl-5-methylbenzoate (CAS 1859126-50-3) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: methyl 4-amino-3-ethynyl-5-methylbenzoate. InChIKey: TXMVVAAXNOAWAH-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | methyl 4-amino-3-ethynyl-5-methylbenzoate |
| InChIKey | TXMVVAAXNOAWAH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1N)C#C)C(=O)OC |
Computed by PubChem (NCBI)