Products 185915-25-7
CAS 185915-25-7 appears in our catalog under these names: L-Menthyl lactate, 98%, (1R,2S,5R)-2-Isopropyl-5-methylcyclohexyl 2-hydroxypropanoate, 98%, L–Menthyl lactate, L-Menthyl lactate, 97%, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 100g, 5g, 25g, 1g, 500g.
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-hydroxypropanoate (CAS 185915-25-7) is a chemical compound with the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. IUPAC name: [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-hydroxypropanoate. InChIKey: UJNOLBSYLSYIBM-SGUBAKSOSA-N.
| Molecular formula | C13H24O3 |
|---|---|
| Molecular weight | 228.33 g/mol |
| IUPAC name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-hydroxypropanoate |
| InChIKey | UJNOLBSYLSYIBM-SGUBAKSOSA-N |
| SMILES | C[C@@H]1CC[C@H]([C@@H](C1)OC(=O)C(C)O)C(C)C |
Computed by PubChem (NCBI)
Synonyms:
frescolat ML, (-)-menthyl lactate, (R)-(1R,2S,5R)-2-Isopropyl-5-methylcyclohexyl 2-hydroxypropanoate, [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-hydroxypropanoate, L-Menthyl lactate, >=97%, (-)-p-Menthan-3-yl lactate, L-Menthyl lactate, >=97%, FG, [(1R,2S,5R)-2-isopropyl-5-methyl-cyclohexyl] 2-hydroxypropanoate, (1R,2S,5R)-2-Isopropyl-5-methylcyclohexyl 2-hydroxypropanoate, AldrichCPR