CAS 59259-38-0 is the registry number for L-Menthyl Lactate, >95% (GC). Offered by: TRC. Available pack sizes: 10g, 1g, 5g.
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2R)-2-hydroxypropanoate (CAS 59259-38-0) is a chemical compound with the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. IUPAC name: [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2R)-2-hydroxypropanoate. InChIKey: UJNOLBSYLSYIBM-WISYIIOYSA-N.
| Molecular formula | C13H24O3 |
|---|---|
| Molecular weight | 228.33 g/mol |
| IUPAC name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2R)-2-hydroxypropanoate |
| InChIKey | UJNOLBSYLSYIBM-WISYIIOYSA-N |
| SMILES | C[C@@H]1CC[C@H]([C@@H](C1)OC(=O)[C@@H](C)O)C(C)C |
Computed by PubChem (NCBI)