CAS 61597-98-6 appears in our catalog under these names: (1R,2S,5R)-2-Isopropyl-5-methylcyclohexyl (S)-2-Hydroxypropionate, >98.0%(GC), (S)-(1R,2S,5R)-2-Isopropyl-5-methylcyclohexyl 2-hydroxypropanoate, 98%. Offered by: TCI, Fluorochem, Ambeed. Available pack sizes: 5g, 25g, 100g, 500g.
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S)-2-hydroxypropanoate (CAS 61597-98-6) is a chemical compound with the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. IUPAC name: [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S)-2-hydroxypropanoate. InChIKey: UJNOLBSYLSYIBM-NOOOWODRSA-N.
| Molecular formula | C13H24O3 |
|---|---|
| Molecular weight | 228.33 g/mol |
| IUPAC name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S)-2-hydroxypropanoate |
| InChIKey | UJNOLBSYLSYIBM-NOOOWODRSA-N |
| SMILES | C[C@@H]1CC[C@H]([C@@H](C1)OC(=O)[C@H](C)O)C(C)C |
Computed by PubChem (NCBI)