CAS 1862485-03-7 is the registry number for 1-butyl-5-nitro-1H-pyrazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-butyl-5-nitropyrazole (CAS 1862485-03-7) is a chemical compound with the molecular formula C7H11N3O2 and a molecular weight of 169.18 g/mol. IUPAC name: 1-butyl-5-nitropyrazole. InChIKey: GEBXQFAZHRJQCZ-UHFFFAOYSA-N.
| Molecular formula | C7H11N3O2 |
|---|---|
| Molecular weight | 169.18 g/mol |
| IUPAC name | 1-butyl-5-nitropyrazole |
| InChIKey | GEBXQFAZHRJQCZ-UHFFFAOYSA-N |
| SMILES | CCCCN1C(=CC=N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)