CAS 186268-78-0 appears in our catalog under these names: GPI-1485, 95%, GPI-1485/ 99.78% (existing batch purity), GPI–1485, GPI-1485 95%, (S)-1-(3,3-Dimethyl-2-oxopentanoyl)pyrrolidine-2-carboxylic acid, 95%, 95%. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1g, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso).
(2S)-1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidine-2-carboxylic acid (CAS 186268-78-0) is a chemical compound with the molecular formula C12H19NO4 and a molecular weight of 241.28 g/mol. IUPAC name: (2S)-1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidine-2-carboxylic acid. InChIKey: FOPALECPEUVCTL-QMMMGPOBSA-N.
| Molecular formula | C12H19NO4 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | (2S)-1-(3,3-dimethyl-2-oxopentanoyl)pyrrolidine-2-carboxylic acid |
| InChIKey | FOPALECPEUVCTL-QMMMGPOBSA-N |
| SMILES | CCC(C)(C)C(=O)C(=O)N1CCC[C@H]1C(=O)O |
Computed by PubChem (NCBI)