CAS 1862745-41-2 is the registry number for 2-(3-Cyclopropyl-1,2,4-oxadiazol-5-yl)-2,2-difluoroethan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-2,2-difluoroethanamine (CAS 1862745-41-2) is a chemical compound with the molecular formula C7H9F2N3O and a molecular weight of 189.16 g/mol. IUPAC name: 2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-2,2-difluoroethanamine. InChIKey: YNPFRVUQULVAHG-UHFFFAOYSA-N.
| Molecular formula | C7H9F2N3O |
|---|---|
| Molecular weight | 189.16 g/mol |
| IUPAC name | 2-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-2,2-difluoroethanamine |
| InChIKey | YNPFRVUQULVAHG-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NOC(=N2)C(CN)(F)F |
Computed by PubChem (NCBI)