Products 2827059-43-6
CAS 2827059-43-6 is the registry number for 4-(1,1-Difluoroethyl)-6-methoxypyrimidin-2-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(1,1-difluoroethyl)-6-methoxypyrimidin-2-amine (CAS 2827059-43-6) is a chemical compound with the molecular formula C7H9F2N3O and a molecular weight of 189.16 g/mol. IUPAC name: 4-(1,1-difluoroethyl)-6-methoxypyrimidin-2-amine. InChIKey: VZJPZGWVKNTULD-UHFFFAOYSA-N.
| Molecular formula | C7H9F2N3O |
|---|---|
| Molecular weight | 189.16 g/mol |
| IUPAC name | 4-(1,1-difluoroethyl)-6-methoxypyrimidin-2-amine |
| InChIKey | VZJPZGWVKNTULD-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=NC(=N1)N)OC)(F)F |
Computed by PubChem (NCBI)