CAS 2097936-51-9 is the registry number for 3-(4,4-Difluoropyrrolidin-2-yl)-5-methyl-1,2,4-oxadiazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4,4-difluoropyrrolidin-2-yl)-5-methyl-1,2,4-oxadiazole (CAS 2097936-51-9) is a chemical compound with the molecular formula C7H9F2N3O and a molecular weight of 189.16 g/mol. IUPAC name: 3-(4,4-difluoropyrrolidin-2-yl)-5-methyl-1,2,4-oxadiazole. InChIKey: RLXQPVAENNRRFO-UHFFFAOYSA-N.
| Molecular formula | C7H9F2N3O |
|---|---|
| Molecular weight | 189.16 g/mol |
| IUPAC name | 3-(4,4-difluoropyrrolidin-2-yl)-5-methyl-1,2,4-oxadiazole |
| InChIKey | RLXQPVAENNRRFO-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NO1)C2CC(CN2)(F)F |
Computed by PubChem (NCBI)