CAS 18637-52-0 is the registry number for 1H,2H,3H,4H-Pyrazino(1,2-a)indole hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
1,2,3,4-tetrahydropyrazino[1,2-a]indole;hydrochloride (CAS 18637-52-0) is a chemical compound with the molecular formula C11H13ClN2 and a molecular weight of 208.69 g/mol. IUPAC name: 1,2,3,4-tetrahydropyrazino[1,2-a]indole;hydrochloride. InChIKey: UQSOAYJBJBCUJT-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2 |
|---|---|
| Molecular weight | 208.69 g/mol |
| IUPAC name | 1,2,3,4-tetrahydropyrazino[1,2-a]indole;hydrochloride |
| InChIKey | UQSOAYJBJBCUJT-UHFFFAOYSA-N |
| SMILES | C1CN2C(=CC3=CC=CC=C32)CN1.Cl |
Computed by PubChem (NCBI)