CAS 1864057-70-4 is the registry number for 3-((4-Fluorophenoxy)methyl)azetidine Hydrochloride. Offered by: TRC. Available pack sizes: 500mg.
3-[(4-fluorophenoxy)methyl]azetidine;hydrochloride (CAS 1864057-70-4) is a chemical compound with the molecular formula C10H13ClFNO and a molecular weight of 217.67 g/mol. IUPAC name: 3-[(4-fluorophenoxy)methyl]azetidine;hydrochloride. InChIKey: CIFDRJVFRCXFTC-UHFFFAOYSA-N.
| Molecular formula | C10H13ClFNO |
|---|---|
| Molecular weight | 217.67 g/mol |
| IUPAC name | 3-[(4-fluorophenoxy)methyl]azetidine;hydrochloride |
| InChIKey | CIFDRJVFRCXFTC-UHFFFAOYSA-N |
| SMILES | C1C(CN1)COC2=CC=C(C=C2)F.Cl |
Computed by PubChem (NCBI)