Products 1864061-39-1

CAS 1864061-39-1 is the registry number for 1-Propanoylcyclopropane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

1-propanoylcyclopropane-1-carboxylic acid (CAS 1864061-39-1) is a chemical compound with the molecular formula C7H10O3 and a molecular weight of 142.15 g/mol. IUPAC name: 1-propanoylcyclopropane-1-carboxylic acid. InChIKey: HDCZSBZRGCNQBI-UHFFFAOYSA-N.

Identity
Molecular formulaC7H10O3
Molecular weight142.15 g/mol
IUPAC name1-propanoylcyclopropane-1-carboxylic acid
InChIKeyHDCZSBZRGCNQBI-UHFFFAOYSA-N
SMILESCCC(=O)C1(CC1)C(=O)O

Computed by PubChem (NCBI)