CAS 186498-30-6 appears in our catalog under these names: 3-(4-Bromophenyl)-2,2-dimethylpropanoic acid, 3-(4-Bromophenyl)-2,2-dimethylpropanoic acid, 95%, 95%, 3-(4-Bromophenyl)-2,2-dimethylpropanoic acid, 97%, 3-(4-Bromophenyl)-2,2-dimethylpropanoic acid, 95%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 100mg, 250mg, 5g, 10g, 50mg, 500mg, 2.5g.
3-(4-bromophenyl)-2,2-dimethylpropanoic acid (CAS 186498-30-6) is a chemical compound with the molecular formula C11H13BrO2 and a molecular weight of 257.12 g/mol. IUPAC name: 3-(4-bromophenyl)-2,2-dimethylpropanoic acid. InChIKey: WOROXVNNDXPWCP-UHFFFAOYSA-N.
| Molecular formula | C11H13BrO2 |
|---|---|
| Molecular weight | 257.12 g/mol |
| IUPAC name | 3-(4-bromophenyl)-2,2-dimethylpropanoic acid |
| InChIKey | WOROXVNNDXPWCP-UHFFFAOYSA-N |
| SMILES | CC(C)(CC1=CC=C(C=C1)Br)C(=O)O |
Computed by PubChem (NCBI)