Products 1865773-05-2
CAS 1865773-05-2 is the registry number for 2-Cyano-3-(1-methyl-1H-imidazol-4-yl)acrylic acid, 95%. Offered by: Ambeed, BLDpharm, Chemat. Available pack sizes: 250mg, 1g, 100mg.
(E)-2-cyano-3-(1-methylimidazol-4-yl)prop-2-enoic acid (CAS 1865773-05-2) is a chemical compound with the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. IUPAC name: (E)-2-cyano-3-(1-methylimidazol-4-yl)prop-2-enoic acid. InChIKey: LGJINGOMHJGTCG-QHHAFSJGSA-N.
| Molecular formula | C8H7N3O2 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | (E)-2-cyano-3-(1-methylimidazol-4-yl)prop-2-enoic acid |
| InChIKey | LGJINGOMHJGTCG-QHHAFSJGSA-N |
| SMILES | CN1C=C(N=C1)/C=C(\C#N)/C(=O)O |
Computed by PubChem (NCBI)