CAS 1866485-70-2 is the registry number for 2,2-Dimethylchromane-4,6-diamine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2-dimethyl-3,4-dihydrochromene-4,6-diamine (CAS 1866485-70-2) is a chemical compound with the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. IUPAC name: 2,2-dimethyl-3,4-dihydrochromene-4,6-diamine. InChIKey: FYCCFZCOLQCEAC-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O |
|---|---|
| Molecular weight | 192.26 g/mol |
| IUPAC name | 2,2-dimethyl-3,4-dihydrochromene-4,6-diamine |
| InChIKey | FYCCFZCOLQCEAC-UHFFFAOYSA-N |
| SMILES | CC1(CC(C2=C(O1)C=CC(=C2)N)N)C |
Computed by PubChem (NCBI)