CAS 1932108-12-7 is the registry number for (R)-2,2-Dimethylchromane-4,6-diamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4R)-2,2-dimethyl-3,4-dihydrochromene-4,6-diamine (CAS 1932108-12-7) is a chemical compound with the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. IUPAC name: (4R)-2,2-dimethyl-3,4-dihydrochromene-4,6-diamine. InChIKey: FYCCFZCOLQCEAC-SECBINFHSA-N.
| Molecular formula | C11H16N2O |
|---|---|
| Molecular weight | 192.26 g/mol |
| IUPAC name | (4R)-2,2-dimethyl-3,4-dihydrochromene-4,6-diamine |
| InChIKey | FYCCFZCOLQCEAC-SECBINFHSA-N |
| SMILES | CC1(C[C@H](C2=C(O1)C=CC(=C2)N)N)C |
Computed by PubChem (NCBI)