Products 1867129-42-7
CAS 1867129-42-7 is the registry number for N3-Pen-Dtpp. Offered by: Iris Biotech, MedChemExpress. Available pack sizes: 1g, 5g, 250mg, Get quote.
5-(5-azidopentanoyl)-6-hydroxy-1,3-dimethylpyrimidine-2,4-dione (CAS 1867129-42-7) is a chemical compound with the molecular formula C11H15N5O4 and a molecular weight of 281.27 g/mol. IUPAC name: 5-(5-azidopentanoyl)-6-hydroxy-1,3-dimethylpyrimidine-2,4-dione. InChIKey: ZYDYGNXJSVZCSR-UHFFFAOYSA-N.
| Molecular formula | C11H15N5O4 |
|---|---|
| Molecular weight | 281.27 g/mol |
| IUPAC name | 5-(5-azidopentanoyl)-6-hydroxy-1,3-dimethylpyrimidine-2,4-dione |
| InChIKey | ZYDYGNXJSVZCSR-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C(=O)N(C1=O)C)C(=O)CCCCN=[N+]=[N-])O |
Computed by PubChem (NCBI)