CAS 1868106-04-0 is the registry number for 2-(tert-Butyl) 6-methyl 8-bromo-3,4,6,7-tetrahydroisoquinoline-2,6(1H)-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-O-tert-butyl 6-O-methyl 8-bromo-3,4,6,7-tetrahydro-1H-isoquinoline-2,6-dicarboxylate (CAS 1868106-04-0) is a chemical compound with the molecular formula C16H22BrNO4 and a molecular weight of 372.25 g/mol. IUPAC name: 2-O-tert-butyl 6-O-methyl 8-bromo-3,4,6,7-tetrahydro-1H-isoquinoline-2,6-dicarboxylate. InChIKey: UZCLOLPLFRLLGG-UHFFFAOYSA-N.
| Molecular formula | C16H22BrNO4 |
|---|---|
| Molecular weight | 372.25 g/mol |
| IUPAC name | 2-O-tert-butyl 6-O-methyl 8-bromo-3,4,6,7-tetrahydro-1H-isoquinoline-2,6-dicarboxylate |
| InChIKey | UZCLOLPLFRLLGG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=CC(CC(=C2C1)Br)C(=O)OC |
Computed by PubChem (NCBI)