CAS 2139153-76-5 is the registry number for 3-(3-Bromophenyl)-2-((tert-butoxycarbonyl)amino)pentanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(3-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 2139153-76-5) is a chemical compound with the molecular formula C16H22BrNO4 and a molecular weight of 372.25 g/mol. IUPAC name: 3-(3-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: WNRGYRVZJGOYMB-UHFFFAOYSA-N.
| Molecular formula | C16H22BrNO4 |
|---|---|
| Molecular weight | 372.25 g/mol |
| IUPAC name | 3-(3-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | WNRGYRVZJGOYMB-UHFFFAOYSA-N |
| SMILES | CCC(C1=CC(=CC=C1)Br)C(C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)