CAS 95656-97-6 is the registry number for (S)-Benzyl 4-bromo-2-((tert-butoxycarbonyl)amino)butanoate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl (2S)-4-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (CAS 95656-97-6) is a chemical compound with the molecular formula C16H22BrNO4 and a molecular weight of 372.25 g/mol. IUPAC name: benzyl (2S)-4-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate. InChIKey: DSCCTRCWUPSJIV-ZDUSSCGKSA-N.
| Molecular formula | C16H22BrNO4 |
|---|---|
| Molecular weight | 372.25 g/mol |
| IUPAC name | benzyl (2S)-4-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| InChIKey | DSCCTRCWUPSJIV-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCBr)C(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)